C11H15F6NO3 — CID 162555067
[5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentan-2-yl] 2-(aziridin-2-yl)propanoate (PubChem CID 162555067) has the molecular formula C11H15F6NO3 and a molecular weight of 323.23 g/mol. Its IUPAC name is [5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentan-2-yl] 2-(aziridin-2-yl)propanoate.
| Compound Name | [5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentan-2-yl] 2-(aziridin-2-yl)propanoate |
|---|---|
| PubChem CID | 162555067 |
| Molecular Formula | C11H15F6NO3 |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | [5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentan-2-yl] 2-(aziridin-2-yl)propanoate |
| SMILES | CC(CC(O)(C(F)(F)F)C(F)(F)F)OC(=O)C(C)C1CN1 |
| InChI | InChI=1S/C11H15F6NO3/c1-5(21-8(19)6(2)7-4-18-7)3-9(20,10(12,13)14)11(15,16)17/h5-7,18,20H,3-4H2,1-2H3 |
| InChIKey | WQYBIRYNPCRPFZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 68.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|