C24H22F3N3O2 — CID 162555182
3-[4-[5-[4-(2-methylpropyl)-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]indol-1-yl]propanal (PubChem CID 162555182) has the molecular formula C24H22F3N3O2 and a molecular weight of 441.45 g/mol. Its IUPAC name is 3-[4-[5-[4-(2-methylpropyl)-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]indol-1-yl]propanal.
| Compound Name | 3-[4-[5-[4-(2-methylpropyl)-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]indol-1-yl]propanal |
|---|---|
| PubChem CID | 162555182 |
| Molecular Formula | C24H22F3N3O2 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 3-[4-[5-[4-(2-methylpropyl)-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]indol-1-yl]propanal |
| SMILES | CC(C)Cc1ccc(-c2nc(-c3cccc4c3ccn4CCC=O)no2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H22F3N3O2/c1-15(2)13-16-7-8-17(14-20(16)24(25,26)27)23-28-22(29-32-23)19-5-3-6-21-18(19)9-11-30(21)10-4-12-31/h3,5-9,11-12,14-15H,4,10,13H2,1-2H3 |
| InChIKey | AEKVOUCGJRKQFW-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|