About ethyl 3-[1-[2-amino-4-(1,1-difluoropropyl)phenyl]imidazol-2-yl]propanoate
ethyl 3-[1-[2-amino-4-(1,1-difluoropropyl)phenyl]imidazol-2-yl]propanoate (PubChem CID 162555278) has the molecular formula C17H21F2N3O2
and a molecular weight of 337.37 g/mol. Its IUPAC name is ethyl 3-[1-[2-amino-4-(1,1-difluoropropyl)phenyl]imidazol-2-yl]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[1-[2-amino-4-(1,1-difluoropropyl)phenyl]imidazol-2-yl]propanoate |
| PubChem CID | 162555278 |
| Molecular Formula | C17H21F2N3O2 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | ethyl 3-[1-[2-amino-4-(1,1-difluoropropyl)phenyl]imidazol-2-yl]propanoate |
| SMILES | CCOC(=O)CCc1nccn1-c1ccc(C(F)(F)CC)cc1N |
| InChI | InChI=1S/C17H21F2N3O2/c1-3-17(18,19)12-5-6-14(13(20)11-12)22-10-9-21-15(22)7-8-16(23)24-4-2/h5-6,9-11H,3-4,7-8,20H2,1-2H3 |
| InChIKey | GPOPUJMQDIDHRD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[1-[2-amino-4-(1,1-difluoropropyl)phenyl]imidazol-2-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[1-[2-amino-4-(1,1-difluoropropyl)phenyl]imidazol-2-yl]propanoate?
The IUPAC name of ethyl 3-[1-[2-amino-4-(1,1-difluoropropyl)phenyl]imidazol-2-yl]propanoate (CID 162555278) is ethyl 3-[1-[2-amino-4-(1,1-difluoropropyl)phenyl]imidazol-2-yl]propanoate.
What is the SMILES notation for ethyl 3-[1-[2-amino-4-(1,1-difluoropropyl)phenyl]imidazol-2-yl]propanoate?
The canonical SMILES for ethyl 3-[1-[2-amino-4-(1,1-difluoropropyl)phenyl]imidazol-2-yl]propanoate is CCOC(=O)CCc1nccn1-c1ccc(C(F)(F)CC)cc1N.
What is the InChIKey of ethyl 3-[1-[2-amino-4-(1,1-difluoropropyl)phenyl]imidazol-2-yl]propanoate?
The InChIKey is GPOPUJMQDIDHRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F2N3O2/c1-3-17(18,19)12-5-6-14(13(20)11-12)22-10-9-21-15(22)7-8-16(23)24-4-2/h5-6,9-11H,3-4,7-8,20H2,1-2H3.
What are the key properties of ethyl 3-[1-[2-amino-4-(1,1-difluoropropyl)phenyl]imidazol-2-yl]propanoate?
ethyl 3-[1-[2-amino-4-(1,1-difluoropropyl)phenyl]imidazol-2-yl]propanoate has a molecular weight of 337.37 g/mol, XLogP of 3.45, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[1-[2-amino-4-(1,1-difluoropropyl)phenyl]imidazol-2-yl]propanoate is sourced from PubChem (CID 162555278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).