About [2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-iodo-2-methylpentanoate
[2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-iodo-2-methylpentanoate (PubChem CID 162555485) has the molecular formula C15H24F3IO3
and a molecular weight of 436.25 g/mol. Its IUPAC name is [2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-iodo-2-methylpentanoate.
Molecular Properties
| Compound Name | [2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-iodo-2-methylpentanoate |
| PubChem CID | 162555485 |
| Molecular Formula | C15H24F3IO3 |
| Molecular Weight | 436.25 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | [2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-iodo-2-methylpentanoate |
| SMILES | CCCC(C)(I)C(=O)OC1CCCCC1C(C)(O)C(F)(F)F |
| InChI | InChI=1S/C15H24F3IO3/c1-4-9-13(2,19)12(20)22-11-8-6-5-7-10(11)14(3,21)15(16,17)18/h10-11,21H,4-9H2,1-3H3 |
| InChIKey | AUIWKGSUNQTYTB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.25 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-iodo-2-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-iodo-2-methylpentanoate?
The IUPAC name of [2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-iodo-2-methylpentanoate (CID 162555485) is [2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-iodo-2-methylpentanoate.
What is the SMILES notation for [2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-iodo-2-methylpentanoate?
The canonical SMILES for [2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-iodo-2-methylpentanoate is CCCC(C)(I)C(=O)OC1CCCCC1C(C)(O)C(F)(F)F.
What is the InChIKey of [2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-iodo-2-methylpentanoate?
The InChIKey is AUIWKGSUNQTYTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24F3IO3/c1-4-9-13(2,19)12(20)22-11-8-6-5-7-10(11)14(3,21)15(16,17)18/h10-11,21H,4-9H2,1-3H3.
What are the key properties of [2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-iodo-2-methylpentanoate?
[2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-iodo-2-methylpentanoate has a molecular weight of 436.25 g/mol, XLogP of 4.40, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-iodo-2-methylpentanoate is sourced from PubChem (CID 162555485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).