C14H14F3IO — CID 162556040
2-iodo-5-[(3Z,5E)-5-(trifluoromethoxy)hepta-1,3,5-trien-2-yl]cyclohexa-1,3-diene (PubChem CID 162556040) has the molecular formula C14H14F3IO and a molecular weight of 382.16 g/mol. Its IUPAC name is 2-iodo-5-[(3Z,5E)-5-(trifluoromethoxy)hepta-1,3,5-trien-2-yl]cyclohexa-1,3-diene.
| Compound Name | 2-iodo-5-[(3Z,5E)-5-(trifluoromethoxy)hepta-1,3,5-trien-2-yl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 162556040 |
| Molecular Formula | C14H14F3IO |
| Molecular Weight | 382.16 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 2-iodo-5-[(3Z,5E)-5-(trifluoromethoxy)hepta-1,3,5-trien-2-yl]cyclohexa-1,3-diene |
| SMILES | C=C(/C=C\C(=C/C)OC(F)(F)F)C1C=CC(I)=CC1 |
| InChI | InChI=1S/C14H14F3IO/c1-3-13(19-14(15,16)17)9-4-10(2)11-5-7-12(18)8-6-11/h3-5,7-9,11H,2,6H2,1H3/b9-4-,13-3+ |
| InChIKey | UCQBIFNANALDMR-LRUAALGCSA-N |
| XLogP | 5.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.16 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|