C13H21F3N2O — CID 162556626
N-(2-aminoethyl)-N-[(Z,2E)-6,6,6-trifluoro-2-propylidenehex-3-enyl]acetamide (PubChem CID 162556626) has the molecular formula C13H21F3N2O and a molecular weight of 278.32 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-[(Z,2E)-6,6,6-trifluoro-2-propylidenehex-3-enyl]acetamide.
| Compound Name | N-(2-aminoethyl)-N-[(Z,2E)-6,6,6-trifluoro-2-propylidenehex-3-enyl]acetamide |
|---|---|
| PubChem CID | 162556626 |
| Molecular Formula | C13H21F3N2O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-(2-aminoethyl)-N-[(Z,2E)-6,6,6-trifluoro-2-propylidenehex-3-enyl]acetamide |
| SMILES | CC/C=C(\C=C/CC(F)(F)F)CN(CCN)C(C)=O |
| InChI | InChI=1S/C13H21F3N2O/c1-3-5-12(6-4-7-13(14,15)16)10-18(9-8-17)11(2)19/h4-6H,3,7-10,17H2,1-2H3/b6-4-,12-5+ |
| InChIKey | ZJLGZOOLZPFSHI-GLNLJRCCSA-N |
| XLogP | 2.64 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|