C44H51F3NO8P — CID 162556761
benzyl N-[1-bis(phenylmethoxy)phosphoryloxy-4-[4-(4-cyclohexylbutoxy)-3-(trifluoromethyl)phenyl]-2-formylbutan-2-yl]carbamate (PubChem CID 162556761) has the molecular formula C44H51F3NO8P and a molecular weight of 809.86 g/mol. Its IUPAC name is benzyl N-[1-bis(phenylmethoxy)phosphoryloxy-4-[4-(4-cyclohexylbutoxy)-3-(trifluoromethyl)phenyl]-2-formylbutan-2-yl]carbamate.
| Compound Name | benzyl N-[1-bis(phenylmethoxy)phosphoryloxy-4-[4-(4-cyclohexylbutoxy)-3-(trifluoromethyl)phenyl]-2-formylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 162556761 |
| Molecular Formula | C44H51F3NO8P |
| Molecular Weight | 809.86 g/mol |
| Exact Mass | 809.33 |
| IUPAC Name | benzyl N-[1-bis(phenylmethoxy)phosphoryloxy-4-[4-(4-cyclohexylbutoxy)-3-(trifluoromethyl)phenyl]-2-formylbutan-2-yl]carbamate |
| SMILES | O=CC(CCc1ccc(OCCCCC2CCCCC2)c(C(F)(F)F)c1)(COP(=O)(OCc1ccccc1)OCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C44H51F3NO8P/c45-44(46,47)40-29-36(24-25-41(40)52-28-14-13-17-35-15-5-1-6-16-35)26-27-43(33-49,48-42(50)53-30-37-18-7-2-8-19-37)34-56-57(51,54-31-38-20-9-3-10-21-38)55-32-39-22-11-4-12-23-39/h2-4,7-12,18-25,29,33,35H,1,5-6,13-17,26-28,30-32,34H2,(H,48,50) |
| InChIKey | PZAOVKOSRQLZOJ-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.86 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|