C31H31F3N2O2 — CID 162556828
N-[[3-(1,1-difluoroprop-2-enyl)phenyl]methyl]-1-[3-(4-fluorophenyl)propanoyl]-4-phenylpiperidine-4-carboxamide (PubChem CID 162556828) has the molecular formula C31H31F3N2O2 and a molecular weight of 520.60 g/mol. Its IUPAC name is N-[[3-(1,1-difluoroprop-2-enyl)phenyl]methyl]-1-[3-(4-fluorophenyl)propanoyl]-4-phenylpiperidine-4-carboxamide.
| Compound Name | N-[[3-(1,1-difluoroprop-2-enyl)phenyl]methyl]-1-[3-(4-fluorophenyl)propanoyl]-4-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 162556828 |
| Molecular Formula | C31H31F3N2O2 |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | N-[[3-(1,1-difluoroprop-2-enyl)phenyl]methyl]-1-[3-(4-fluorophenyl)propanoyl]-4-phenylpiperidine-4-carboxamide |
| SMILES | C=CC(F)(F)c1cccc(CNC(=O)C2(c3ccccc3)CCN(C(=O)CCc3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C31H31F3N2O2/c1-2-31(33,34)26-10-6-7-24(21-26)22-35-29(38)30(25-8-4-3-5-9-25)17-19-36(20-18-30)28(37)16-13-23-11-14-27(32)15-12-23/h2-12,14-15,21H,1,13,16-20,22H2,(H,35,38) |
| InChIKey | UONRMWXKMYPXGT-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|