About 4,5-dimethyl-5-(trifluoromethyl)-1,3-diazepine
4,5-dimethyl-5-(trifluoromethyl)-1,3-diazepine (PubChem CID 162557043) has the molecular formula C8H9F3N2
and a molecular weight of 190.17 g/mol. Its IUPAC name is 4,5-dimethyl-5-(trifluoromethyl)-1,3-diazepine.
Molecular Properties
| Compound Name | 4,5-dimethyl-5-(trifluoromethyl)-1,3-diazepine |
| PubChem CID | 162557043 |
| Molecular Formula | C8H9F3N2 |
| Molecular Weight | 190.17 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 4,5-dimethyl-5-(trifluoromethyl)-1,3-diazepine |
| SMILES | CC1=NC=NC=CC1(C)C(F)(F)F |
| InChI | InChI=1S/C8H9F3N2/c1-6-7(2,8(9,10)11)3-4-12-5-13-6/h3-5H,1-2H3 |
| InChIKey | WCZXVKAUYMCZJQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.17 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-dimethyl-5-(trifluoromethyl)-1,3-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-5-(trifluoromethyl)-1,3-diazepine?
The IUPAC name of 4,5-dimethyl-5-(trifluoromethyl)-1,3-diazepine (CID 162557043) is 4,5-dimethyl-5-(trifluoromethyl)-1,3-diazepine.
What is the SMILES notation for 4,5-dimethyl-5-(trifluoromethyl)-1,3-diazepine?
The canonical SMILES for 4,5-dimethyl-5-(trifluoromethyl)-1,3-diazepine is CC1=NC=NC=CC1(C)C(F)(F)F.
What is the InChIKey of 4,5-dimethyl-5-(trifluoromethyl)-1,3-diazepine?
The InChIKey is WCZXVKAUYMCZJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2/c1-6-7(2,8(9,10)11)3-4-12-5-13-6/h3-5H,1-2H3.
What are the key properties of 4,5-dimethyl-5-(trifluoromethyl)-1,3-diazepine?
4,5-dimethyl-5-(trifluoromethyl)-1,3-diazepine has a molecular weight of 190.17 g/mol, XLogP of 2.57, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-5-(trifluoromethyl)-1,3-diazepine is sourced from PubChem (CID 162557043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).