C24H24F3N3O4 — CID 162557216
1-ethenoxy-4-[4-[5-[5-methyl-4-(trifluoromethoxy)cyclohexa-1,3-dien-1-yl]-1,2,4-oxadiazol-3-yl]indol-1-yl]butan-1-ol (PubChem CID 162557216) has the molecular formula C24H24F3N3O4 and a molecular weight of 475.47 g/mol. Its IUPAC name is 1-ethenoxy-4-[4-[5-[5-methyl-4-(trifluoromethoxy)cyclohexa-1,3-dien-1-yl]-1,2,4-oxadiazol-3-yl]indol-1-yl]butan-1-ol.
| Compound Name | 1-ethenoxy-4-[4-[5-[5-methyl-4-(trifluoromethoxy)cyclohexa-1,3-dien-1-yl]-1,2,4-oxadiazol-3-yl]indol-1-yl]butan-1-ol |
|---|---|
| PubChem CID | 162557216 |
| Molecular Formula | C24H24F3N3O4 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 1-ethenoxy-4-[4-[5-[5-methyl-4-(trifluoromethoxy)cyclohexa-1,3-dien-1-yl]-1,2,4-oxadiazol-3-yl]indol-1-yl]butan-1-ol |
| SMILES | C=COC(O)CCCn1ccc2c(-c3noc(C4=CC=C(OC(F)(F)F)C(C)C4)n3)cccc21 |
| InChI | InChI=1S/C24H24F3N3O4/c1-3-32-21(31)8-5-12-30-13-11-17-18(6-4-7-19(17)30)22-28-23(34-29-22)16-9-10-20(15(2)14-16)33-24(25,26)27/h3-4,6-7,9-11,13,15,21,31H,1,5,8,12,14H2,2H3 |
| InChIKey | FPTPGFRMKJWFJO-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 82.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|