C16H13Cl3F3N3O — CID 162558088
[2-chloro-5-[(5S)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]cyclohexa-1,5-dien-1-yl]hydrazine (PubChem CID 162558088) has the molecular formula C16H13Cl3F3N3O and a molecular weight of 426.65 g/mol. Its IUPAC name is [2-chloro-5-[(5S)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]cyclohexa-1,5-dien-1-yl]hydrazine.
| Compound Name | [2-chloro-5-[(5S)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]cyclohexa-1,5-dien-1-yl]hydrazine |
|---|---|
| PubChem CID | 162558088 |
| Molecular Formula | C16H13Cl3F3N3O |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | [2-chloro-5-[(5S)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]cyclohexa-1,5-dien-1-yl]hydrazine |
| SMILES | NNC1=C(Cl)CCC(C2=NO[C@@](c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)=C1 |
| InChI | InChI=1S/C16H13Cl3F3N3O/c17-10-4-9(5-11(18)6-10)15(16(20,21)22)7-14(25-26-15)8-1-2-12(19)13(3-8)24-23/h3-6,24H,1-2,7,23H2/t15-/m0/s1 |
| InChIKey | HRWLYLTZLCYAKK-HNNXBMFYSA-N |
| XLogP | 5.16 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|