About 1-(1,1-difluoroethyl)-2-methyl-6-(methylsulfonylmethyl)cyclohexa-1,3-diene
1-(1,1-difluoroethyl)-2-methyl-6-(methylsulfonylmethyl)cyclohexa-1,3-diene (PubChem CID 162558149) has the molecular formula C11H16F2O2S
and a molecular weight of 250.31 g/mol. Its IUPAC name is 1-(1,1-difluoroethyl)-2-methyl-6-(methylsulfonylmethyl)cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 1-(1,1-difluoroethyl)-2-methyl-6-(methylsulfonylmethyl)cyclohexa-1,3-diene |
| PubChem CID | 162558149 |
| Molecular Formula | C11H16F2O2S |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 1-(1,1-difluoroethyl)-2-methyl-6-(methylsulfonylmethyl)cyclohexa-1,3-diene |
| SMILES | CC1=C(C(C)(F)F)C(CS(C)(=O)=O)CC=C1 |
| InChI | InChI=1S/C11H16F2O2S/c1-8-5-4-6-9(7-16(3,14)15)10(8)11(2,12)13/h4-5,9H,6-7H2,1-3H3 |
| InChIKey | JUPCYVXIRCTXJC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1,1-difluoroethyl)-2-methyl-6-(methylsulfonylmethyl)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-difluoroethyl)-2-methyl-6-(methylsulfonylmethyl)cyclohexa-1,3-diene?
The IUPAC name of 1-(1,1-difluoroethyl)-2-methyl-6-(methylsulfonylmethyl)cyclohexa-1,3-diene (CID 162558149) is 1-(1,1-difluoroethyl)-2-methyl-6-(methylsulfonylmethyl)cyclohexa-1,3-diene.
What is the SMILES notation for 1-(1,1-difluoroethyl)-2-methyl-6-(methylsulfonylmethyl)cyclohexa-1,3-diene?
The canonical SMILES for 1-(1,1-difluoroethyl)-2-methyl-6-(methylsulfonylmethyl)cyclohexa-1,3-diene is CC1=C(C(C)(F)F)C(CS(C)(=O)=O)CC=C1.
What is the InChIKey of 1-(1,1-difluoroethyl)-2-methyl-6-(methylsulfonylmethyl)cyclohexa-1,3-diene?
The InChIKey is JUPCYVXIRCTXJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F2O2S/c1-8-5-4-6-9(7-16(3,14)15)10(8)11(2,12)13/h4-5,9H,6-7H2,1-3H3.
What are the key properties of 1-(1,1-difluoroethyl)-2-methyl-6-(methylsulfonylmethyl)cyclohexa-1,3-diene?
1-(1,1-difluoroethyl)-2-methyl-6-(methylsulfonylmethyl)cyclohexa-1,3-diene has a molecular weight of 250.31 g/mol, XLogP of 2.58, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-difluoroethyl)-2-methyl-6-(methylsulfonylmethyl)cyclohexa-1,3-diene is sourced from PubChem (CID 162558149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).