C24H22F3N5OS — CID 162558164
4-[6-(2-aminophenyl)sulfanyl-8-(3,3,3-trifluoropropylamino)imidazo[1,2-a]pyridin-3-yl]-2-methylbenzamide (PubChem CID 162558164) has the molecular formula C24H22F3N5OS and a molecular weight of 485.54 g/mol. Its IUPAC name is 4-[6-(2-aminophenyl)sulfanyl-8-(3,3,3-trifluoropropylamino)imidazo[1,2-a]pyridin-3-yl]-2-methylbenzamide.
| Compound Name | 4-[6-(2-aminophenyl)sulfanyl-8-(3,3,3-trifluoropropylamino)imidazo[1,2-a]pyridin-3-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 162558164 |
| Molecular Formula | C24H22F3N5OS |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 4-[6-(2-aminophenyl)sulfanyl-8-(3,3,3-trifluoropropylamino)imidazo[1,2-a]pyridin-3-yl]-2-methylbenzamide |
| SMILES | Cc1cc(-c2cnc3c(NCCC(F)(F)F)cc(Sc4ccccc4N)cn23)ccc1C(N)=O |
| InChI | InChI=1S/C24H22F3N5OS/c1-14-10-15(6-7-17(14)22(29)33)20-12-31-23-19(30-9-8-24(25,26)27)11-16(13-32(20)23)34-21-5-3-2-4-18(21)28/h2-7,10-13,30H,8-9,28H2,1H3,(H2,29,33) |
| InChIKey | GINIJEIVRWYFBB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|