C9H7F3S2 — CID 162558427
[7-(trifluoromethyl)cyclohepta-1,2,4,6-tetraen-1-yl]methanedithiol (PubChem CID 162558427) has the molecular formula C9H7F3S2 and a molecular weight of 236.28 g/mol. Its IUPAC name is [7-(trifluoromethyl)cyclohepta-1,2,4,6-tetraen-1-yl]methanedithiol.
| Compound Name | [7-(trifluoromethyl)cyclohepta-1,2,4,6-tetraen-1-yl]methanedithiol |
|---|---|
| PubChem CID | 162558427 |
| Molecular Formula | C9H7F3S2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 235.99 |
| IUPAC Name | [7-(trifluoromethyl)cyclohepta-1,2,4,6-tetraen-1-yl]methanedithiol |
| SMILES | FC(F)(F)C1=CC=CC=C=C1C(S)S |
| InChI | InChI=1S/C9H7F3S2/c10-9(11,12)7-5-3-1-2-4-6(7)8(13)14/h1-3,5,8,13-14H |
| InChIKey | ZTWDOUDZPLAKRR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|