C7H11F3N2 — CID 162558665
(Z)-3,3,3-trifluoro-N,N-dimethyl-2-(methyliminomethyl)prop-1-en-1-amine (PubChem CID 162558665) has the molecular formula C7H11F3N2 and a molecular weight of 180.17 g/mol. Its IUPAC name is (Z)-3,3,3-trifluoro-N,N-dimethyl-2-(methyliminomethyl)prop-1-en-1-amine.
| Compound Name | (Z)-3,3,3-trifluoro-N,N-dimethyl-2-(methyliminomethyl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 162558665 |
| Molecular Formula | C7H11F3N2 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (Z)-3,3,3-trifluoro-N,N-dimethyl-2-(methyliminomethyl)prop-1-en-1-amine |
| SMILES | C/N=C/C(=C/N(C)C)C(F)(F)F |
| InChI | InChI=1S/C7H11F3N2/c1-11-4-6(5-12(2)3)7(8,9)10/h4-5H,1-3H3/b6-5-,11-4+ |
| InChIKey | PMLAAKBYJXHPNY-VWXLBWAMSA-N |
| XLogP | 1.69 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|