C23H29F3N2O4 — CID 162558684
8-ethyl-4-[5-[4-hydroxy-3-(trifluoromethyl)anilino]pentanoyl]-3-methyl-1-oxa-8-azaspiro[4.5]dec-3-en-2-one (PubChem CID 162558684) has the molecular formula C23H29F3N2O4 and a molecular weight of 454.49 g/mol. Its IUPAC name is 8-ethyl-4-[5-[4-hydroxy-3-(trifluoromethyl)anilino]pentanoyl]-3-methyl-1-oxa-8-azaspiro[4.5]dec-3-en-2-one.
| Compound Name | 8-ethyl-4-[5-[4-hydroxy-3-(trifluoromethyl)anilino]pentanoyl]-3-methyl-1-oxa-8-azaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 162558684 |
| Molecular Formula | C23H29F3N2O4 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 8-ethyl-4-[5-[4-hydroxy-3-(trifluoromethyl)anilino]pentanoyl]-3-methyl-1-oxa-8-azaspiro[4.5]dec-3-en-2-one |
| SMILES | CCN1CCC2(CC1)OC(=O)C(C)=C2C(=O)CCCCNc1ccc(O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H29F3N2O4/c1-3-28-12-9-22(10-13-28)20(15(2)21(31)32-22)19(30)6-4-5-11-27-16-7-8-18(29)17(14-16)23(24,25)26/h7-8,14,27,29H,3-6,9-13H2,1-2H3 |
| InChIKey | ILQBPWRBJDWNPB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|