C11H13F4N — CID 162558950
1-(cyclohexa-2,4-dien-1-ylmethyl)-3,3,4,4-tetrafluoropyrrolidine (PubChem CID 162558950) has the molecular formula C11H13F4N and a molecular weight of 235.22 g/mol. Its IUPAC name is 1-(cyclohexa-2,4-dien-1-ylmethyl)-3,3,4,4-tetrafluoropyrrolidine.
| Compound Name | 1-(cyclohexa-2,4-dien-1-ylmethyl)-3,3,4,4-tetrafluoropyrrolidine |
|---|---|
| PubChem CID | 162558950 |
| Molecular Formula | C11H13F4N |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 1-(cyclohexa-2,4-dien-1-ylmethyl)-3,3,4,4-tetrafluoropyrrolidine |
| SMILES | FC1(F)CN(CC2C=CC=CC2)CC1(F)F |
| InChI | InChI=1S/C11H13F4N/c12-10(13)7-16(8-11(10,14)15)6-9-4-2-1-3-5-9/h1-4,9H,5-8H2 |
| InChIKey | NALDIEQPKVSCNK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|