About 4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxybutane-1,1-diol
4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxybutane-1,1-diol (PubChem CID 162559010) has the molecular formula C18H17F3O4
and a molecular weight of 354.32 g/mol. Its IUPAC name is 4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxybutane-1,1-diol.
Molecular Properties
| Compound Name | 4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxybutane-1,1-diol |
| PubChem CID | 162559010 |
| Molecular Formula | C18H17F3O4 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxybutane-1,1-diol |
| SMILES | OC(O)CCCOc1ccc2c(c1)C(O)(C(F)(F)F)c1ccccc1-2 |
| InChI | InChI=1S/C18H17F3O4/c19-18(20,21)17(24)14-5-2-1-4-12(14)13-8-7-11(10-15(13)17)25-9-3-6-16(22)23/h1-2,4-5,7-8,10,16,22-24H,3,6,9H2 |
| InChIKey | YYRJDIWTEJGVDS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxybutane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxybutane-1,1-diol?
The IUPAC name of 4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxybutane-1,1-diol (CID 162559010) is 4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxybutane-1,1-diol.
What is the SMILES notation for 4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxybutane-1,1-diol?
The canonical SMILES for 4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxybutane-1,1-diol is OC(O)CCCOc1ccc2c(c1)C(O)(C(F)(F)F)c1ccccc1-2.
What is the InChIKey of 4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxybutane-1,1-diol?
The InChIKey is YYRJDIWTEJGVDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F3O4/c19-18(20,21)17(24)14-5-2-1-4-12(14)13-8-7-11(10-15(13)17)25-9-3-6-16(22)23/h1-2,4-5,7-8,10,16,22-24H,3,6,9H2.
What are the key properties of 4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxybutane-1,1-diol?
4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxybutane-1,1-diol has a molecular weight of 354.32 g/mol, XLogP of 2.93, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxybutane-1,1-diol is sourced from PubChem (CID 162559010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).