C12H17F3N2O2 — CID 162559559
4-cyclobutyl-3-(ethenylamino)-2-oxo-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 162559559) has the molecular formula C12H17F3N2O2 and a molecular weight of 278.27 g/mol. Its IUPAC name is 4-cyclobutyl-3-(ethenylamino)-2-oxo-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | 4-cyclobutyl-3-(ethenylamino)-2-oxo-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 162559559 |
| Molecular Formula | C12H17F3N2O2 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 4-cyclobutyl-3-(ethenylamino)-2-oxo-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | C=CNC(CC1CCC1)C(=O)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C12H17F3N2O2/c1-2-16-9(6-8-4-3-5-8)10(18)11(19)17-7-12(13,14)15/h2,8-9,16H,1,3-7H2,(H,17,19) |
| InChIKey | WVTWIBBHFBCGNV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|