C12H17F5N2O6S2 — CID 162559660
2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-1,1-difluoro-N-hydroxy-2-oxo-N-(trifluoromethylsulfonyl)ethanesulfonamide (PubChem CID 162559660) has the molecular formula C12H17F5N2O6S2 and a molecular weight of 444.40 g/mol. Its IUPAC name is 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-1,1-difluoro-N-hydroxy-2-oxo-N-(trifluoromethylsulfonyl)ethanesulfonamide.
| Compound Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-1,1-difluoro-N-hydroxy-2-oxo-N-(trifluoromethylsulfonyl)ethanesulfonamide |
|---|---|
| PubChem CID | 162559660 |
| Molecular Formula | C12H17F5N2O6S2 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-1,1-difluoro-N-hydroxy-2-oxo-N-(trifluoromethylsulfonyl)ethanesulfonamide |
| SMILES | O=C(N1CCCC2CCCCC21)C(F)(F)S(=O)(=O)N(O)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H17F5N2O6S2/c13-11(14,26(22,23)19(21)27(24,25)12(15,16)17)10(20)18-7-3-5-8-4-1-2-6-9(8)18/h8-9,21H,1-7H2 |
| InChIKey | NBOBLLQKBZOIGY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|