C30H44F3N3O6S — CID 162559810
8-[(E)-2-[4-[(3R)-3,4-dihydroxybutoxy]-2,6-dimethylphenyl]ethenyl]sulfonyl-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 162559810) has the molecular formula C30H44F3N3O6S and a molecular weight of 631.76 g/mol. Its IUPAC name is 8-[(E)-2-[4-[(3R)-3,4-dihydroxybutoxy]-2,6-dimethylphenyl]ethenyl]sulfonyl-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-[(E)-2-[4-[(3R)-3,4-dihydroxybutoxy]-2,6-dimethylphenyl]ethenyl]sulfonyl-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 162559810 |
| Molecular Formula | C30H44F3N3O6S |
| Molecular Weight | 631.76 g/mol |
| Exact Mass | 631.29 |
| IUPAC Name | 8-[(E)-2-[4-[(3R)-3,4-dihydroxybutoxy]-2,6-dimethylphenyl]ethenyl]sulfonyl-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | Cc1cc(OCC[C@@H](O)CO)cc(C)c1/C=C/S(=O)(=O)N1CCC2(CC1)NC(C1CCC(CCC(F)(F)F)CC1)NC2=O |
| InChI | InChI=1S/C30H44F3N3O6S/c1-20-17-25(42-15-8-24(38)19-37)18-21(2)26(20)9-16-43(40,41)36-13-11-29(12-14-36)28(39)34-27(35-29)23-5-3-22(4-6-23)7-10-30(31,32)33/h9,16-18,22-24,27,35,37-38H,3-8,10-15,19H2,1-2H3,(H,34,39)/b16-9+/t22?,23?,24-,27?/m1/s1 |
| InChIKey | XQCYFXDYFXXDMT-SVKRQBPUSA-N |
| XLogP | 3.76 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.76 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |