C23H25F3N2O — CID 162559985
2-[(2E,4Z)-6-(4-methylcyclohexa-1,5-dien-1-yl)hexa-2,4-dien-3-yl]-5-[1-methyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-1,3,4-oxadiazole (PubChem CID 162559985) has the molecular formula C23H25F3N2O and a molecular weight of 402.46 g/mol. Its IUPAC name is 2-[(2E,4Z)-6-(4-methylcyclohexa-1,5-dien-1-yl)hexa-2,4-dien-3-yl]-5-[1-methyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-1,3,4-oxadiazole.
| Compound Name | 2-[(2E,4Z)-6-(4-methylcyclohexa-1,5-dien-1-yl)hexa-2,4-dien-3-yl]-5-[1-methyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 162559985 |
| Molecular Formula | C23H25F3N2O |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 2-[(2E,4Z)-6-(4-methylcyclohexa-1,5-dien-1-yl)hexa-2,4-dien-3-yl]-5-[1-methyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-1,3,4-oxadiazole |
| SMILES | C/C=C(\C=C/CC1=CCC(C)C=C1)c1nnc(C2(C)C=CC(C(F)(F)F)=CC2)o1 |
| InChI | InChI=1S/C23H25F3N2O/c1-4-18(7-5-6-17-10-8-16(2)9-11-17)20-27-28-21(29-20)22(3)14-12-19(13-15-22)23(24,25)26/h4-5,7-8,10-14,16H,6,9,15H2,1-3H3/b7-5-,18-4+ |
| InChIKey | IGVRRMYKMRSDFP-IEEHNQBISA-N |
| XLogP | 6.65 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|