C15H18F3N — CID 162560061
N-[[6-methyl-5-(trifluoromethyl)-1,2,4a,5-tetrahydronaphthalen-2-yl]methyl]ethenamine (PubChem CID 162560061) has the molecular formula C15H18F3N and a molecular weight of 269.31 g/mol. Its IUPAC name is N-[[6-methyl-5-(trifluoromethyl)-1,2,4a,5-tetrahydronaphthalen-2-yl]methyl]ethenamine.
| Compound Name | N-[[6-methyl-5-(trifluoromethyl)-1,2,4a,5-tetrahydronaphthalen-2-yl]methyl]ethenamine |
|---|---|
| PubChem CID | 162560061 |
| Molecular Formula | C15H18F3N |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-[[6-methyl-5-(trifluoromethyl)-1,2,4a,5-tetrahydronaphthalen-2-yl]methyl]ethenamine |
| SMILES | C=CNCC1C=CC2C(=CC=C(C)C2C(F)(F)F)C1 |
| InChI | InChI=1S/C15H18F3N/c1-3-19-9-11-5-7-13-12(8-11)6-4-10(2)14(13)15(16,17)18/h3-7,11,13-14,19H,1,8-9H2,2H3 |
| InChIKey | TWCCRIJQWSKYHI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|