C17H9F6N3O4 — CID 162560563
6-(trifluoromethyl)-3-(6,6,10-trifluoro-2-prop-2-ynyl-4,7-dioxa-2-azatricyclo[6.4.0.03,5]dodeca-1(8),9,11-trien-11-yl)-1H-pyrimidine-2,4-dione (PubChem CID 162560563) has the molecular formula C17H9F6N3O4 and a molecular weight of 433.26 g/mol. Its IUPAC name is 6-(trifluoromethyl)-3-(6,6,10-trifluoro-2-prop-2-ynyl-4,7-dioxa-2-azatricyclo[6.4.0.03,5]dodeca-1(8),9,11-trien-11-yl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(trifluoromethyl)-3-(6,6,10-trifluoro-2-prop-2-ynyl-4,7-dioxa-2-azatricyclo[6.4.0.03,5]dodeca-1(8),9,11-trien-11-yl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 162560563 |
| Molecular Formula | C17H9F6N3O4 |
| Molecular Weight | 433.26 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 6-(trifluoromethyl)-3-(6,6,10-trifluoro-2-prop-2-ynyl-4,7-dioxa-2-azatricyclo[6.4.0.03,5]dodeca-1(8),9,11-trien-11-yl)-1H-pyrimidine-2,4-dione |
| SMILES | C#CCN1c2cc(-n3c(=O)cc(C(F)(F)F)[nH]c3=O)c(F)cc2OC(F)(F)C2OC21 |
| InChI | InChI=1S/C17H9F6N3O4/c1-2-3-25-9-5-8(26-12(27)6-11(16(19,20)21)24-15(26)28)7(18)4-10(9)30-17(22,23)13-14(25)29-13/h1,4-6,13-14H,3H2,(H,24,28) |
| InChIKey | WRZYSXBKMFYFBJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 79.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|