C19H22F3N7O3 — CID 162560648
ethyl 2-(4a-methyl-7,7a-dihydropyrrolo[2,3-d]pyrimidin-5-yl)-6-[[(2S)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]amino]pyrimidine-4-carboxylate (PubChem CID 162560648) has the molecular formula C19H22F3N7O3 and a molecular weight of 453.43 g/mol. Its IUPAC name is ethyl 2-(4a-methyl-7,7a-dihydropyrrolo[2,3-d]pyrimidin-5-yl)-6-[[(2S)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]amino]pyrimidine-4-carboxylate.
| Compound Name | ethyl 2-(4a-methyl-7,7a-dihydropyrrolo[2,3-d]pyrimidin-5-yl)-6-[[(2S)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]amino]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 162560648 |
| Molecular Formula | C19H22F3N7O3 |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | ethyl 2-(4a-methyl-7,7a-dihydropyrrolo[2,3-d]pyrimidin-5-yl)-6-[[(2S)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]amino]pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)c1cc(N[C@@H](C)C(=O)NCC(F)(F)F)nc(C2=CNC3N=CN=CC23C)n1 |
| InChI | InChI=1S/C19H22F3N7O3/c1-4-32-16(31)12-5-13(27-10(2)15(30)25-8-19(20,21)22)29-14(28-12)11-6-24-17-18(11,3)7-23-9-26-17/h5-7,9-10,17,24H,4,8H2,1-3H3,(H,25,30)(H,27,28,29)/t10-,17?,18?/m0/s1 |
| InChIKey | SVHMMFYVORGIAS-DVEYYSSOSA-N |
| XLogP | 1.52 |
| TPSA | 129.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |