C28H33F3N2O4 — CID 162560740
[(6R)-9-hydroxy-7,7-dimethyl-4-propan-2-yl-3-[6-(trifluoromethyl)-3-pyridinyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-6-yl] acetate (PubChem CID 162560740) has the molecular formula C28H33F3N2O4 and a molecular weight of 518.58 g/mol. Its IUPAC name is [(6R)-9-hydroxy-7,7-dimethyl-4-propan-2-yl-3-[6-(trifluoromethyl)-3-pyridinyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-6-yl] acetate.
| Compound Name | [(6R)-9-hydroxy-7,7-dimethyl-4-propan-2-yl-3-[6-(trifluoromethyl)-3-pyridinyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-6-yl] acetate |
|---|---|
| PubChem CID | 162560740 |
| Molecular Formula | C28H33F3N2O4 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | [(6R)-9-hydroxy-7,7-dimethyl-4-propan-2-yl-3-[6-(trifluoromethyl)-3-pyridinyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1c2nc(C(C)C)c3c(c2C(O)CC1(C)C)C1(CCCC1)OC3c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C28H33F3N2O4/c1-14(2)22-20-21(19-17(35)12-26(4,5)25(23(19)33-22)36-15(3)34)27(10-6-7-11-27)37-24(20)16-8-9-18(32-13-16)28(29,30)31/h8-9,13-14,17,24-25,35H,6-7,10-12H2,1-5H3/t17?,24?,25-/m0/s1 |
| InChIKey | GZCPKEPLARSLMN-RIIRKCAYSA-N |
| XLogP | 6.58 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |