C30H31F6N3O4 — CID 162560922
tert-butyl (Z,2S)-5,5,5-trifluoro-3-[[(3R)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]methylcarbamoyl]-2-(3,3,3-trifluoropropyl)pent-3-enoate (PubChem CID 162560922) has the molecular formula C30H31F6N3O4 and a molecular weight of 611.58 g/mol. Its IUPAC name is tert-butyl (Z,2S)-5,5,5-trifluoro-3-[[(3R)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]methylcarbamoyl]-2-(3,3,3-trifluoropropyl)pent-3-enoate.
| Compound Name | tert-butyl (Z,2S)-5,5,5-trifluoro-3-[[(3R)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]methylcarbamoyl]-2-(3,3,3-trifluoropropyl)pent-3-enoate |
|---|---|
| PubChem CID | 162560922 |
| Molecular Formula | C30H31F6N3O4 |
| Molecular Weight | 611.58 g/mol |
| Exact Mass | 611.22 |
| IUPAC Name | tert-butyl (Z,2S)-5,5,5-trifluoro-3-[[(3R)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]methylcarbamoyl]-2-(3,3,3-trifluoropropyl)pent-3-enoate |
| SMILES | CN1C(=O)[C@@H](CNC(=O)/C(=C\C(F)(F)F)[C@H](CCC(F)(F)F)C(=O)OC(C)(C)C)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C30H31F6N3O4/c1-28(2,3)43-27(42)19(14-15-29(31,32)33)21(16-30(34,35)36)25(40)37-17-22-26(41)39(4)23-13-9-8-12-20(23)24(38-22)18-10-6-5-7-11-18/h5-13,16,19,22H,14-15,17H2,1-4H3,(H,37,40)/b21-16-/t19-,22+/m0/s1 |
| InChIKey | CDQWBZHBRWRDKB-QHOZKDOGSA-N |
| XLogP | 5.77 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.58 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|