C30H36F3N5O3 — CID 162560960
2-(aminomethylidene)-N-[5-methoxy-6-(4-morpholin-4-ylcyclohexen-1-yl)-3-pyridinyl]-3-[4-(trifluoromethyl)cycloocta-1,3,5-trien-1-yl]iminobutanamide (PubChem CID 162560960) has the molecular formula C30H36F3N5O3 and a molecular weight of 571.64 g/mol. Its IUPAC name is 2-(aminomethylidene)-N-[5-methoxy-6-(4-morpholin-4-ylcyclohexen-1-yl)-3-pyridinyl]-3-[4-(trifluoromethyl)cycloocta-1,3,5-trien-1-yl]iminobutanamide.
| Compound Name | 2-(aminomethylidene)-N-[5-methoxy-6-(4-morpholin-4-ylcyclohexen-1-yl)-3-pyridinyl]-3-[4-(trifluoromethyl)cycloocta-1,3,5-trien-1-yl]iminobutanamide |
|---|---|
| PubChem CID | 162560960 |
| Molecular Formula | C30H36F3N5O3 |
| Molecular Weight | 571.64 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | 2-(aminomethylidene)-N-[5-methoxy-6-(4-morpholin-4-ylcyclohexen-1-yl)-3-pyridinyl]-3-[4-(trifluoromethyl)cycloocta-1,3,5-trien-1-yl]iminobutanamide |
| SMILES | COc1cc(NC(=O)C(=CN)/C(C)=N/C2=CC=C(C(F)(F)F)C=CCC2)cnc1C1=CCC(N2CCOCC2)CC1 |
| InChI | InChI=1S/C30H36F3N5O3/c1-20(36-23-6-4-3-5-22(9-10-23)30(31,32)33)26(18-34)29(39)37-24-17-27(40-2)28(35-19-24)21-7-11-25(12-8-21)38-13-15-41-16-14-38/h3,5,7,9-10,17-19,25H,4,6,8,11-16,34H2,1-2H3,(H,37,39)/b5-3?,22-9?,23-10?,26-18?,36-20+ |
| InChIKey | CRKAKALEWMSALJ-JRPAVIBHSA-N |
| XLogP | 5.32 |
| TPSA | 102.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.64 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|