C22H23ClF4N6O — CID 162560967
N-[[(4R)-4-(4-chloro-3-fluorophenyl)pyrrolidin-3-yl]methylidene]-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxamide (PubChem CID 162560967) has the molecular formula C22H23ClF4N6O and a molecular weight of 498.91 g/mol. Its IUPAC name is N-[[(4R)-4-(4-chloro-3-fluorophenyl)pyrrolidin-3-yl]methylidene]-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxamide.
| Compound Name | N-[[(4R)-4-(4-chloro-3-fluorophenyl)pyrrolidin-3-yl]methylidene]-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 162560967 |
| Molecular Formula | C22H23ClF4N6O |
| Molecular Weight | 498.91 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | N-[[(4R)-4-(4-chloro-3-fluorophenyl)pyrrolidin-3-yl]methylidene]-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxamide |
| SMILES | C[C@@H](Nc1ncc2c(n1)CN(C(=O)N=CC1CNC[C@H]1c1ccc(Cl)c(F)c1)CC2)C(F)(F)F |
| InChI | InChI=1S/C22H23ClF4N6O/c1-12(22(25,26)27)31-20-29-8-14-4-5-33(11-19(14)32-20)21(34)30-9-15-7-28-10-16(15)13-2-3-17(23)18(24)6-13/h2-3,6,8-9,12,15-16,28H,4-5,7,10-11H2,1H3,(H,29,31,32)/t12-,15?,16+/m1/s1 |
| InChIKey | NDCOBBPJFGYBPZ-TYVLWQRCSA-N |
| XLogP | 4.18 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.91 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|