C22H19F3N4O4 — CID 162561025
[(2S)-1-[[6-[6-[(3,3-difluorocyclobutyl)methoxy]-1,3-benzoxazol-2-yl]-5-fluoro-3-pyridinyl]oxy]but-3-yn-2-yl]urea (PubChem CID 162561025) has the molecular formula C22H19F3N4O4 and a molecular weight of 460.41 g/mol. Its IUPAC name is [(2S)-1-[[6-[6-[(3,3-difluorocyclobutyl)methoxy]-1,3-benzoxazol-2-yl]-5-fluoro-3-pyridinyl]oxy]but-3-yn-2-yl]urea.
| Compound Name | [(2S)-1-[[6-[6-[(3,3-difluorocyclobutyl)methoxy]-1,3-benzoxazol-2-yl]-5-fluoro-3-pyridinyl]oxy]but-3-yn-2-yl]urea |
|---|---|
| PubChem CID | 162561025 |
| Molecular Formula | C22H19F3N4O4 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | [(2S)-1-[[6-[6-[(3,3-difluorocyclobutyl)methoxy]-1,3-benzoxazol-2-yl]-5-fluoro-3-pyridinyl]oxy]but-3-yn-2-yl]urea |
| SMILES | C#C[C@@H](COc1cnc(-c2nc3ccc(OCC4CC(F)(F)C4)cc3o2)c(F)c1)NC(N)=O |
| InChI | InChI=1S/C22H19F3N4O4/c1-2-13(28-21(26)30)11-32-15-5-16(23)19(27-9-15)20-29-17-4-3-14(6-18(17)33-20)31-10-12-7-22(24,25)8-12/h1,3-6,9,12-13H,7-8,10-11H2,(H3,26,28,30)/t13-/m0/s1 |
| InChIKey | ZSUCCNSLFMNMGM-ZDUSSCGKSA-N |
| XLogP | 3.50 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|