About 5-(trifluoromethyl)-3a,4-dihydro-1H-indol-6-amine
5-(trifluoromethyl)-3a,4-dihydro-1H-indol-6-amine (PubChem CID 162561099) has the molecular formula C9H9F3N2
and a molecular weight of 202.18 g/mol. Its IUPAC name is 5-(trifluoromethyl)-3a,4-dihydro-1H-indol-6-amine.
Molecular Properties
| Compound Name | 5-(trifluoromethyl)-3a,4-dihydro-1H-indol-6-amine |
| PubChem CID | 162561099 |
| Molecular Formula | C9H9F3N2 |
| Molecular Weight | 202.18 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 5-(trifluoromethyl)-3a,4-dihydro-1H-indol-6-amine |
| SMILES | NC1=C(C(F)(F)F)CC2C=CNC2=C1 |
| InChI | InChI=1S/C9H9F3N2/c10-9(11,12)6-3-5-1-2-14-8(5)4-7(6)13/h1-2,4-5,14H,3,13H2 |
| InChIKey | BRZQTLBBAWBNLE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.18 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(trifluoromethyl)-3a,4-dihydro-1H-indol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(trifluoromethyl)-3a,4-dihydro-1H-indol-6-amine?
The IUPAC name of 5-(trifluoromethyl)-3a,4-dihydro-1H-indol-6-amine (CID 162561099) is 5-(trifluoromethyl)-3a,4-dihydro-1H-indol-6-amine.
What is the SMILES notation for 5-(trifluoromethyl)-3a,4-dihydro-1H-indol-6-amine?
The canonical SMILES for 5-(trifluoromethyl)-3a,4-dihydro-1H-indol-6-amine is NC1=C(C(F)(F)F)CC2C=CNC2=C1.
What is the InChIKey of 5-(trifluoromethyl)-3a,4-dihydro-1H-indol-6-amine?
The InChIKey is BRZQTLBBAWBNLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F3N2/c10-9(11,12)6-3-5-1-2-14-8(5)4-7(6)13/h1-2,4-5,14H,3,13H2.
What are the key properties of 5-(trifluoromethyl)-3a,4-dihydro-1H-indol-6-amine?
5-(trifluoromethyl)-3a,4-dihydro-1H-indol-6-amine has a molecular weight of 202.18 g/mol, XLogP of 1.78, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(trifluoromethyl)-3a,4-dihydro-1H-indol-6-amine is sourced from PubChem (CID 162561099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).