About 4-methyl-6-methylidene-8-(trifluoromethyl)pyrimido[1,6-b]pyridazine
4-methyl-6-methylidene-8-(trifluoromethyl)pyrimido[1,6-b]pyridazine (PubChem CID 162561232) has the molecular formula C10H8F3N3
and a molecular weight of 227.19 g/mol. Its IUPAC name is 4-methyl-6-methylidene-8-(trifluoromethyl)pyrimido[1,6-b]pyridazine.
Molecular Properties
| Compound Name | 4-methyl-6-methylidene-8-(trifluoromethyl)pyrimido[1,6-b]pyridazine |
| PubChem CID | 162561232 |
| Molecular Formula | C10H8F3N3 |
| Molecular Weight | 227.19 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 4-methyl-6-methylidene-8-(trifluoromethyl)pyrimido[1,6-b]pyridazine |
| SMILES | C=C1C=C2C(C)=CC=NN2C(C(F)(F)F)=N1 |
| InChI | InChI=1S/C10H8F3N3/c1-6-3-4-14-16-8(6)5-7(2)15-9(16)10(11,12)13/h3-5H,2H2,1H3 |
| InChIKey | ZBOFLTHGCPGUNQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.19 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-6-methylidene-8-(trifluoromethyl)pyrimido[1,6-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-6-methylidene-8-(trifluoromethyl)pyrimido[1,6-b]pyridazine?
The IUPAC name of 4-methyl-6-methylidene-8-(trifluoromethyl)pyrimido[1,6-b]pyridazine (CID 162561232) is 4-methyl-6-methylidene-8-(trifluoromethyl)pyrimido[1,6-b]pyridazine.
What is the SMILES notation for 4-methyl-6-methylidene-8-(trifluoromethyl)pyrimido[1,6-b]pyridazine?
The canonical SMILES for 4-methyl-6-methylidene-8-(trifluoromethyl)pyrimido[1,6-b]pyridazine is C=C1C=C2C(C)=CC=NN2C(C(F)(F)F)=N1.
What is the InChIKey of 4-methyl-6-methylidene-8-(trifluoromethyl)pyrimido[1,6-b]pyridazine?
The InChIKey is ZBOFLTHGCPGUNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3N3/c1-6-3-4-14-16-8(6)5-7(2)15-9(16)10(11,12)13/h3-5H,2H2,1H3.
What are the key properties of 4-methyl-6-methylidene-8-(trifluoromethyl)pyrimido[1,6-b]pyridazine?
4-methyl-6-methylidene-8-(trifluoromethyl)pyrimido[1,6-b]pyridazine has a molecular weight of 227.19 g/mol, XLogP of 2.61, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-6-methylidene-8-(trifluoromethyl)pyrimido[1,6-b]pyridazine is sourced from PubChem (CID 162561232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).