C23H32F3N3O4S — CID 162561313
N-[1-(2,2-dihydroxyethyl)-4,5,6,7-tetrahydroindazol-4-yl]-3-(4,4-dimethylpentan-2-yl)-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 162561313) has the molecular formula C23H32F3N3O4S and a molecular weight of 503.59 g/mol. Its IUPAC name is N-[1-(2,2-dihydroxyethyl)-4,5,6,7-tetrahydroindazol-4-yl]-3-(4,4-dimethylpentan-2-yl)-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[1-(2,2-dihydroxyethyl)-4,5,6,7-tetrahydroindazol-4-yl]-3-(4,4-dimethylpentan-2-yl)-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 162561313 |
| Molecular Formula | C23H32F3N3O4S |
| Molecular Weight | 503.59 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | N-[1-(2,2-dihydroxyethyl)-4,5,6,7-tetrahydroindazol-4-yl]-3-(4,4-dimethylpentan-2-yl)-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(CC(C)(C)C)c1cc(C(F)(F)F)cc(S(=O)(=O)NC2CCCc3c2cnn3CC(O)O)c1 |
| InChI | InChI=1S/C23H32F3N3O4S/c1-14(11-22(2,3)4)15-8-16(23(24,25)26)10-17(9-15)34(32,33)28-19-6-5-7-20-18(19)12-27-29(20)13-21(30)31/h8-10,12,14,19,21,28,30-31H,5-7,11,13H2,1-4H3 |
| InChIKey | KOZDKWVFXDKCEK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|