C15H23F3N4 — CID 162561488
5-[[(3S)-3-(methylamino)cyclopentyl]methyl]-N-(4,4,4-trifluorobutyl)pyridazin-3-amine (PubChem CID 162561488) has the molecular formula C15H23F3N4 and a molecular weight of 316.37 g/mol. Its IUPAC name is 5-[[(3S)-3-(methylamino)cyclopentyl]methyl]-N-(4,4,4-trifluorobutyl)pyridazin-3-amine.
| Compound Name | 5-[[(3S)-3-(methylamino)cyclopentyl]methyl]-N-(4,4,4-trifluorobutyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 162561488 |
| Molecular Formula | C15H23F3N4 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 5-[[(3S)-3-(methylamino)cyclopentyl]methyl]-N-(4,4,4-trifluorobutyl)pyridazin-3-amine |
| SMILES | CN[C@H]1CCC(Cc2cnnc(NCCCC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C15H23F3N4/c1-19-13-4-3-11(8-13)7-12-9-14(22-21-10-12)20-6-2-5-15(16,17)18/h9-11,13,19H,2-8H2,1H3,(H,20,22)/t11?,13-/m0/s1 |
| InChIKey | KAKDNIRXPMAORQ-YUZLPWPTSA-N |
| XLogP | 3.16 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|