C27H31F3N4O3S — CID 162561528
N-[5-(4,4-difluoropiperidine-1-carbonyl)-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1,3-thiazol-2-yl]-2-[[(4-fluorophenyl)-hydroxymethyl]amino]-2-methylpropanamide (PubChem CID 162561528) has the molecular formula C27H31F3N4O3S and a molecular weight of 548.63 g/mol. Its IUPAC name is N-[5-(4,4-difluoropiperidine-1-carbonyl)-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1,3-thiazol-2-yl]-2-[[(4-fluorophenyl)-hydroxymethyl]amino]-2-methylpropanamide.
| Compound Name | N-[5-(4,4-difluoropiperidine-1-carbonyl)-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1,3-thiazol-2-yl]-2-[[(4-fluorophenyl)-hydroxymethyl]amino]-2-methylpropanamide |
|---|---|
| PubChem CID | 162561528 |
| Molecular Formula | C27H31F3N4O3S |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | N-[5-(4,4-difluoropiperidine-1-carbonyl)-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1,3-thiazol-2-yl]-2-[[(4-fluorophenyl)-hydroxymethyl]amino]-2-methylpropanamide |
| SMILES | C=C/C(=C\C=C/C)c1nc(NC(=O)C(C)(C)NC(O)c2ccc(F)cc2)sc1C(=O)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C27H31F3N4O3S/c1-5-7-8-17(6-2)20-21(23(36)34-15-13-27(29,30)14-16-34)38-25(31-20)32-24(37)26(3,4)33-22(35)18-9-11-19(28)12-10-18/h5-12,22,33,35H,2,13-16H2,1,3-4H3,(H,31,32,37)/b7-5-,17-8+ |
| InChIKey | YRXYEQLBJFOZHC-DJZAMEBTSA-N |
| XLogP | 5.30 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|