About 3-(2-methylpropylamino)-1-(trifluoromethyl)cyclohepta-2,4,6-triene-1-thiol
3-(2-methylpropylamino)-1-(trifluoromethyl)cyclohepta-2,4,6-triene-1-thiol (PubChem CID 162561853) has the molecular formula C12H16F3NS
and a molecular weight of 263.33 g/mol. Its IUPAC name is 3-(2-methylpropylamino)-1-(trifluoromethyl)cyclohepta-2,4,6-triene-1-thiol.
Molecular Properties
| Compound Name | 3-(2-methylpropylamino)-1-(trifluoromethyl)cyclohepta-2,4,6-triene-1-thiol |
| PubChem CID | 162561853 |
| Molecular Formula | C12H16F3NS |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 3-(2-methylpropylamino)-1-(trifluoromethyl)cyclohepta-2,4,6-triene-1-thiol |
| SMILES | CC(C)CNC1=CC(S)(C(F)(F)F)C=CC=C1 |
| InChI | InChI=1S/C12H16F3NS/c1-9(2)8-16-10-5-3-4-6-11(17,7-10)12(13,14)15/h3-7,9,16-17H,8H2,1-2H3 |
| InChIKey | IIDZEGBNMHSBSD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methylpropylamino)-1-(trifluoromethyl)cyclohepta-2,4,6-triene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylpropylamino)-1-(trifluoromethyl)cyclohepta-2,4,6-triene-1-thiol?
The IUPAC name of 3-(2-methylpropylamino)-1-(trifluoromethyl)cyclohepta-2,4,6-triene-1-thiol (CID 162561853) is 3-(2-methylpropylamino)-1-(trifluoromethyl)cyclohepta-2,4,6-triene-1-thiol.
What is the SMILES notation for 3-(2-methylpropylamino)-1-(trifluoromethyl)cyclohepta-2,4,6-triene-1-thiol?
The canonical SMILES for 3-(2-methylpropylamino)-1-(trifluoromethyl)cyclohepta-2,4,6-triene-1-thiol is CC(C)CNC1=CC(S)(C(F)(F)F)C=CC=C1.
What is the InChIKey of 3-(2-methylpropylamino)-1-(trifluoromethyl)cyclohepta-2,4,6-triene-1-thiol?
The InChIKey is IIDZEGBNMHSBSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F3NS/c1-9(2)8-16-10-5-3-4-6-11(17,7-10)12(13,14)15/h3-7,9,16-17H,8H2,1-2H3.
What are the key properties of 3-(2-methylpropylamino)-1-(trifluoromethyl)cyclohepta-2,4,6-triene-1-thiol?
3-(2-methylpropylamino)-1-(trifluoromethyl)cyclohepta-2,4,6-triene-1-thiol has a molecular weight of 263.33 g/mol, XLogP of 3.47, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylpropylamino)-1-(trifluoromethyl)cyclohepta-2,4,6-triene-1-thiol is sourced from PubChem (CID 162561853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).