C16H18Cl2F3N3O4 — CID 162561944
1-[(Z)-4-amino-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-en-2-yl]-3-(1,3-dioxolan-2-ylmethyl)urea (PubChem CID 162561944) has the molecular formula C16H18Cl2F3N3O4 and a molecular weight of 444.24 g/mol. Its IUPAC name is 1-[(Z)-4-amino-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-en-2-yl]-3-(1,3-dioxolan-2-ylmethyl)urea.
| Compound Name | 1-[(Z)-4-amino-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-en-2-yl]-3-(1,3-dioxolan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 162561944 |
| Molecular Formula | C16H18Cl2F3N3O4 |
| Molecular Weight | 444.24 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | 1-[(Z)-4-amino-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]but-2-en-2-yl]-3-(1,3-dioxolan-2-ylmethyl)urea |
| SMILES | C/C(=C/C(N)Oc1c(Cl)cc(C(F)(F)F)cc1Cl)NC(=O)NCC1OCCO1 |
| InChI | InChI=1S/C16H18Cl2F3N3O4/c1-8(24-15(25)23-7-13-26-2-3-27-13)4-12(22)28-14-10(17)5-9(6-11(14)18)16(19,20)21/h4-6,12-13H,2-3,7,22H2,1H3,(H2,23,24,25)/b8-4- |
| InChIKey | UPNRBGZFJODFJF-YWEYNIOJSA-N |
| XLogP | 3.25 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.24 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|