C14H5Br2F3N4 — CID 162562384
2,9-dibromo-6-methyl-13-(trifluoromethyl)-5,7,12,14-tetrazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,5,7,9,11,13,15-octaene (PubChem CID 162562384) has the molecular formula C14H5Br2F3N4 and a molecular weight of 446.02 g/mol. Its IUPAC name is 2,9-dibromo-6-methyl-13-(trifluoromethyl)-5,7,12,14-tetrazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,5,7,9,11,13,15-octaene.
| Compound Name | 2,9-dibromo-6-methyl-13-(trifluoromethyl)-5,7,12,14-tetrazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,5,7,9,11,13,15-octaene |
|---|---|
| PubChem CID | 162562384 |
| Molecular Formula | C14H5Br2F3N4 |
| Molecular Weight | 446.02 g/mol |
| Exact Mass | 443.88 |
| IUPAC Name | 2,9-dibromo-6-methyl-13-(trifluoromethyl)-5,7,12,14-tetrazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,5,7,9,11,13,15-octaene |
| SMILES | Cc1nc2cc(Br)c3nc(C(F)(F)F)nc4cc(Br)c(n1)c2c43 |
| InChI | InChI=1S/C14H5Br2F3N4/c1-4-20-7-2-6(16)12-10-8(22-13(23-12)14(17,18)19)3-5(15)11(21-4)9(7)10/h2-3H,1H3 |
| InChIKey | WSSHWJSVFIWPLE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.02 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|