C9H12F3N — CID 162562421
(3E)-3-ethyl-1,1,4-trifluoro-5-methylhexa-3,5-dien-2-imine (PubChem CID 162562421) has the molecular formula C9H12F3N and a molecular weight of 191.20 g/mol. Its IUPAC name is (3E)-3-ethyl-1,1,4-trifluoro-5-methylhexa-3,5-dien-2-imine.
| Compound Name | (3E)-3-ethyl-1,1,4-trifluoro-5-methylhexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 162562421 |
| Molecular Formula | C9H12F3N |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (3E)-3-ethyl-1,1,4-trifluoro-5-methylhexa-3,5-dien-2-imine |
| SMILES | [H]/N=C(C(/CC)=C(/F)C(=C)C)\C(F)F |
| InChI | InChI=1S/C9H12F3N/c1-4-6(7(10)5(2)3)8(13)9(11)12/h9,13H,2,4H2,1,3H3/b7-6+,13-8- |
| InChIKey | XISPBPRAKWZICU-ZLXMBHDQSA-N |
| XLogP | 3.48 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|