C10H17F3O3 — CID 162562514
1-[(2-methylpropan-2-yl)oxy]-2-[(2S)-1,1,1-trifluorobut-3-en-2-yl]oxyethanol (PubChem CID 162562514) has the molecular formula C10H17F3O3 and a molecular weight of 242.24 g/mol. Its IUPAC name is 1-[(2-methylpropan-2-yl)oxy]-2-[(2S)-1,1,1-trifluorobut-3-en-2-yl]oxyethanol.
| Compound Name | 1-[(2-methylpropan-2-yl)oxy]-2-[(2S)-1,1,1-trifluorobut-3-en-2-yl]oxyethanol |
|---|---|
| PubChem CID | 162562514 |
| Molecular Formula | C10H17F3O3 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 1-[(2-methylpropan-2-yl)oxy]-2-[(2S)-1,1,1-trifluorobut-3-en-2-yl]oxyethanol |
| SMILES | C=C[C@H](OCC(O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H17F3O3/c1-5-7(10(11,12)13)15-6-8(14)16-9(2,3)4/h5,7-8,14H,1,6H2,2-4H3/t7-,8?/m0/s1 |
| InChIKey | AHNJQJIXQANFSN-JAMMHHFISA-N |
| XLogP | 2.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|