C33H26F4N2O3S2 — CID 162562749
5-[2-[4-(4-fluorophenyl)phenyl]-1-[3-methyl-4-(nitromethoxy)phenyl]sulfanylethyl]-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole (PubChem CID 162562749) has the molecular formula C33H26F4N2O3S2 and a molecular weight of 638.71 g/mol. Its IUPAC name is 5-[2-[4-(4-fluorophenyl)phenyl]-1-[3-methyl-4-(nitromethoxy)phenyl]sulfanylethyl]-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole.
| Compound Name | 5-[2-[4-(4-fluorophenyl)phenyl]-1-[3-methyl-4-(nitromethoxy)phenyl]sulfanylethyl]-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 162562749 |
| Molecular Formula | C33H26F4N2O3S2 |
| Molecular Weight | 638.71 g/mol |
| Exact Mass | 638.13 |
| IUPAC Name | 5-[2-[4-(4-fluorophenyl)phenyl]-1-[3-methyl-4-(nitromethoxy)phenyl]sulfanylethyl]-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole |
| SMILES | Cc1cc(SC(Cc2ccc(-c3ccc(F)cc3)cc2)c2sc(-c3ccc(C(F)(F)F)cc3)nc2C)ccc1OC[N+](=O)[O-] |
| InChI | InChI=1S/C33H26F4N2O3S2/c1-20-17-28(15-16-29(20)42-19-39(40)41)43-30(18-22-3-5-23(6-4-22)24-9-13-27(34)14-10-24)31-21(2)38-32(44-31)25-7-11-26(12-8-25)33(35,36)37/h3-17,30H,18-19H2,1-2H3 |
| InChIKey | FFNWRDRJDYKDQP-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.71 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|