About (4S)-4-(1,1-difluoro-2-methoxyethyl)cyclohexene
(4S)-4-(1,1-difluoro-2-methoxyethyl)cyclohexene (PubChem CID 162562793) has the molecular formula C9H14F2O
and a molecular weight of 176.21 g/mol. Its IUPAC name is (4S)-4-(1,1-difluoro-2-methoxyethyl)cyclohexene.
Molecular Properties
| Compound Name | (4S)-4-(1,1-difluoro-2-methoxyethyl)cyclohexene |
| PubChem CID | 162562793 |
| Molecular Formula | C9H14F2O |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (4S)-4-(1,1-difluoro-2-methoxyethyl)cyclohexene |
| SMILES | COCC(F)(F)[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C9H14F2O/c1-12-7-9(10,11)8-5-3-2-4-6-8/h2-3,8H,4-7H2,1H3/t8-/m1/s1 |
| InChIKey | ZLDKILONXHXMHM-MRVPVSSYSA-N |
| XLogP | 2.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-(1,1-difluoro-2-methoxyethyl)cyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(1,1-difluoro-2-methoxyethyl)cyclohexene?
The IUPAC name of (4S)-4-(1,1-difluoro-2-methoxyethyl)cyclohexene (CID 162562793) is (4S)-4-(1,1-difluoro-2-methoxyethyl)cyclohexene.
What is the SMILES notation for (4S)-4-(1,1-difluoro-2-methoxyethyl)cyclohexene?
The canonical SMILES for (4S)-4-(1,1-difluoro-2-methoxyethyl)cyclohexene is COCC(F)(F)[C@@H]1CC=CCC1.
What is the InChIKey of (4S)-4-(1,1-difluoro-2-methoxyethyl)cyclohexene?
The InChIKey is ZLDKILONXHXMHM-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H14F2O/c1-12-7-9(10,11)8-5-3-2-4-6-8/h2-3,8H,4-7H2,1H3/t8-/m1/s1.
What are the key properties of (4S)-4-(1,1-difluoro-2-methoxyethyl)cyclohexene?
(4S)-4-(1,1-difluoro-2-methoxyethyl)cyclohexene has a molecular weight of 176.21 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(1,1-difluoro-2-methoxyethyl)cyclohexene is sourced from PubChem (CID 162562793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).