About 2-methylprop-2-enyl 6-(2-methylprop-2-enoxy)-3-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxylate
2-methylprop-2-enyl 6-(2-methylprop-2-enoxy)-3-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxylate (PubChem CID 162562884) has the molecular formula C16H19F3O4
and a molecular weight of 332.32 g/mol. Its IUPAC name is 2-methylprop-2-enyl 6-(2-methylprop-2-enoxy)-3-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | 2-methylprop-2-enyl 6-(2-methylprop-2-enoxy)-3-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxylate |
| PubChem CID | 162562884 |
| Molecular Formula | C16H19F3O4 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-methylprop-2-enyl 6-(2-methylprop-2-enoxy)-3-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxylate |
| SMILES | C=C(C)COC(=O)C1C=C(OC(F)(F)F)C=CC1OCC(=C)C |
| InChI | InChI=1S/C16H19F3O4/c1-10(2)8-21-14-6-5-12(23-16(17,18)19)7-13(14)15(20)22-9-11(3)4/h5-7,13-14H,1,3,8-9H2,2,4H3 |
| InChIKey | HUDIKYXDNMGZPJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enyl 6-(2-methylprop-2-enoxy)-3-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enyl 6-(2-methylprop-2-enoxy)-3-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of 2-methylprop-2-enyl 6-(2-methylprop-2-enoxy)-3-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxylate (CID 162562884) is 2-methylprop-2-enyl 6-(2-methylprop-2-enoxy)-3-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for 2-methylprop-2-enyl 6-(2-methylprop-2-enoxy)-3-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for 2-methylprop-2-enyl 6-(2-methylprop-2-enoxy)-3-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxylate is C=C(C)COC(=O)C1C=C(OC(F)(F)F)C=CC1OCC(=C)C.
What is the InChIKey of 2-methylprop-2-enyl 6-(2-methylprop-2-enoxy)-3-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxylate?
The InChIKey is HUDIKYXDNMGZPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F3O4/c1-10(2)8-21-14-6-5-12(23-16(17,18)19)7-13(14)15(20)22-9-11(3)4/h5-7,13-14H,1,3,8-9H2,2,4H3.
What are the key properties of 2-methylprop-2-enyl 6-(2-methylprop-2-enoxy)-3-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxylate?
2-methylprop-2-enyl 6-(2-methylprop-2-enoxy)-3-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxylate has a molecular weight of 332.32 g/mol, XLogP of 3.67, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enyl 6-(2-methylprop-2-enoxy)-3-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 162562884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).