C17H23F3O — CID 162563724
1-methoxy-4-[(2E,4E)-8,8,8-trifluoro-2,5-dimethylocta-2,4-dien-6-ynyl]cyclohexane (PubChem CID 162563724) has the molecular formula C17H23F3O and a molecular weight of 300.36 g/mol. Its IUPAC name is 1-methoxy-4-[(2E,4E)-8,8,8-trifluoro-2,5-dimethylocta-2,4-dien-6-ynyl]cyclohexane.
| Compound Name | 1-methoxy-4-[(2E,4E)-8,8,8-trifluoro-2,5-dimethylocta-2,4-dien-6-ynyl]cyclohexane |
|---|---|
| PubChem CID | 162563724 |
| Molecular Formula | C17H23F3O |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 1-methoxy-4-[(2E,4E)-8,8,8-trifluoro-2,5-dimethylocta-2,4-dien-6-ynyl]cyclohexane |
| SMILES | COC1CCC(C/C(C)=C/C=C(\C)C#CC(F)(F)F)CC1 |
| InChI | InChI=1S/C17H23F3O/c1-13(10-11-17(18,19)20)4-5-14(2)12-15-6-8-16(21-3)9-7-15/h4-5,15-16H,6-9,12H2,1-3H3/b13-4+,14-5+ |
| InChIKey | XTGJNEHJGGZQET-PCSLFHOQSA-N |
| XLogP | 5.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|