C12H20F6I2O3 — CID 162564047
[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] 2,3-bis(dimethyl-λ3-iodanyl)-2-methylpropanoate (PubChem CID 162564047) has the molecular formula C12H20F6I2O3 and a molecular weight of 580.09 g/mol. Its IUPAC name is [3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] 2,3-bis(dimethyl-λ3-iodanyl)-2-methylpropanoate.
| Compound Name | [3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] 2,3-bis(dimethyl-λ3-iodanyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 162564047 |
| Molecular Formula | C12H20F6I2O3 |
| Molecular Weight | 580.09 g/mol |
| Exact Mass | 579.94 |
| IUPAC Name | [3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] 2,3-bis(dimethyl-λ3-iodanyl)-2-methylpropanoate |
| SMILES | CI(C)CC(C)(C(=O)OCC(O)(C(F)(F)F)C(F)(F)F)I(C)C |
| InChI | InChI=1S/C12H20F6I2O3/c1-9(20(4)5,6-19(2)3)8(21)23-7-10(22,11(13,14)15)12(16,17)18/h22H,6-7H2,1-5H3 |
| InChIKey | KERZOPKVODBWCG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.09 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|