About 5-iodo-4-methyl-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methoxy]pyrimidine
5-iodo-4-methyl-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methoxy]pyrimidine (PubChem CID 162564069) has the molecular formula C13H11F3IN3O2
and a molecular weight of 425.15 g/mol. Its IUPAC name is 5-iodo-4-methyl-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methoxy]pyrimidine.
Molecular Properties
| Compound Name | 5-iodo-4-methyl-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methoxy]pyrimidine |
| PubChem CID | 162564069 |
| Molecular Formula | C13H11F3IN3O2 |
| Molecular Weight | 425.15 g/mol |
| Exact Mass | 424.98 |
| IUPAC Name | 5-iodo-4-methyl-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methoxy]pyrimidine |
| SMILES | Cc1nc(OCc2ccc(OCC(F)(F)F)nc2)ncc1I |
| InChI | InChI=1S/C13H11F3IN3O2/c1-8-10(17)5-19-12(20-8)21-6-9-2-3-11(18-4-9)22-7-13(14,15)16/h2-5H,6-7H2,1H3 |
| InChIKey | UTTGWMWBPFNDMZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.15 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-4-methyl-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methoxy]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-4-methyl-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methoxy]pyrimidine?
The IUPAC name of 5-iodo-4-methyl-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methoxy]pyrimidine (CID 162564069) is 5-iodo-4-methyl-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methoxy]pyrimidine.
What is the SMILES notation for 5-iodo-4-methyl-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methoxy]pyrimidine?
The canonical SMILES for 5-iodo-4-methyl-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methoxy]pyrimidine is Cc1nc(OCc2ccc(OCC(F)(F)F)nc2)ncc1I.
What is the InChIKey of 5-iodo-4-methyl-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methoxy]pyrimidine?
The InChIKey is UTTGWMWBPFNDMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3IN3O2/c1-8-10(17)5-19-12(20-8)21-6-9-2-3-11(18-4-9)22-7-13(14,15)16/h2-5H,6-7H2,1H3.
What are the key properties of 5-iodo-4-methyl-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methoxy]pyrimidine?
5-iodo-4-methyl-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methoxy]pyrimidine has a molecular weight of 425.15 g/mol, XLogP of 3.30, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-4-methyl-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methoxy]pyrimidine is sourced from PubChem (CID 162564069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).