About 2-amino-7-(2,2-difluorobutyl)-6-hydrazinyl-9-(2-hydroxyethyl)purin-8-one
2-amino-7-(2,2-difluorobutyl)-6-hydrazinyl-9-(2-hydroxyethyl)purin-8-one (PubChem CID 162564163) has the molecular formula C11H17F2N7O2
and a molecular weight of 317.30 g/mol. Its IUPAC name is 2-amino-7-(2,2-difluorobutyl)-6-hydrazinyl-9-(2-hydroxyethyl)purin-8-one.
Molecular Properties
| Compound Name | 2-amino-7-(2,2-difluorobutyl)-6-hydrazinyl-9-(2-hydroxyethyl)purin-8-one |
| PubChem CID | 162564163 |
| Molecular Formula | C11H17F2N7O2 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 2-amino-7-(2,2-difluorobutyl)-6-hydrazinyl-9-(2-hydroxyethyl)purin-8-one |
| SMILES | CCC(F)(F)Cn1c(=O)n(CCO)c2nc(N)nc(NN)c21 |
| InChI | InChI=1S/C11H17F2N7O2/c1-2-11(12,13)5-20-6-7(18-15)16-9(14)17-8(6)19(3-4-21)10(20)22/h21H,2-5,15H2,1H3,(H3,14,16,17,18) |
| InChIKey | RCODSEMSWGPCGM-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 137.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-7-(2,2-difluorobutyl)-6-hydrazinyl-9-(2-hydroxyethyl)purin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-7-(2,2-difluorobutyl)-6-hydrazinyl-9-(2-hydroxyethyl)purin-8-one?
The IUPAC name of 2-amino-7-(2,2-difluorobutyl)-6-hydrazinyl-9-(2-hydroxyethyl)purin-8-one (CID 162564163) is 2-amino-7-(2,2-difluorobutyl)-6-hydrazinyl-9-(2-hydroxyethyl)purin-8-one.
What is the SMILES notation for 2-amino-7-(2,2-difluorobutyl)-6-hydrazinyl-9-(2-hydroxyethyl)purin-8-one?
The canonical SMILES for 2-amino-7-(2,2-difluorobutyl)-6-hydrazinyl-9-(2-hydroxyethyl)purin-8-one is CCC(F)(F)Cn1c(=O)n(CCO)c2nc(N)nc(NN)c21.
What is the InChIKey of 2-amino-7-(2,2-difluorobutyl)-6-hydrazinyl-9-(2-hydroxyethyl)purin-8-one?
The InChIKey is RCODSEMSWGPCGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2N7O2/c1-2-11(12,13)5-20-6-7(18-15)16-9(14)17-8(6)19(3-4-21)10(20)22/h21H,2-5,15H2,1H3,(H3,14,16,17,18).
What are the key properties of 2-amino-7-(2,2-difluorobutyl)-6-hydrazinyl-9-(2-hydroxyethyl)purin-8-one?
2-amino-7-(2,2-difluorobutyl)-6-hydrazinyl-9-(2-hydroxyethyl)purin-8-one has a molecular weight of 317.30 g/mol, XLogP of -0.50, 6 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-7-(2,2-difluorobutyl)-6-hydrazinyl-9-(2-hydroxyethyl)purin-8-one is sourced from PubChem (CID 162564163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).