C25H19F3N8O2 — CID 162564475
3-hydroxy-4-[2-(5-methyl-2-pyrimidin-2-yl-1,2,4-triazol-3-yl)hydrazinyl]-N-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxamide (PubChem CID 162564475) has the molecular formula C25H19F3N8O2 and a molecular weight of 520.48 g/mol. Its IUPAC name is 3-hydroxy-4-[2-(5-methyl-2-pyrimidin-2-yl-1,2,4-triazol-3-yl)hydrazinyl]-N-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxamide.
| Compound Name | 3-hydroxy-4-[2-(5-methyl-2-pyrimidin-2-yl-1,2,4-triazol-3-yl)hydrazinyl]-N-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 162564475 |
| Molecular Formula | C25H19F3N8O2 |
| Molecular Weight | 520.48 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | 3-hydroxy-4-[2-(5-methyl-2-pyrimidin-2-yl-1,2,4-triazol-3-yl)hydrazinyl]-N-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxamide |
| SMILES | Cc1nc(NNc2c(O)c(C(=O)Nc3ccc(C(F)(F)F)cc3)cc3ccccc23)n(-c2ncccn2)n1 |
| InChI | InChI=1S/C25H19F3N8O2/c1-14-31-24(36(35-14)23-29-11-4-12-30-23)34-33-20-18-6-3-2-5-15(18)13-19(21(20)37)22(38)32-17-9-7-16(8-10-17)25(26,27)28/h2-13,33,37H,1H3,(H,32,38)(H,31,34,35) |
| InChIKey | MJYDQHPQZODGAL-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.48 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|