C18H18ClF3O5S — CID 162565130
2-[2-chloro-4-(methyl-methylidene-oxo-λ6-sulfanyl)-3-(2,2,2-trifluoroethoxymethyl)benzoyl]cyclohexane-1,3-dione (PubChem CID 162565130) has the molecular formula C18H18ClF3O5S and a molecular weight of 438.85 g/mol. Its IUPAC name is 2-[2-chloro-4-(methyl-methylidene-oxo-λ6-sulfanyl)-3-(2,2,2-trifluoroethoxymethyl)benzoyl]cyclohexane-1,3-dione.
| Compound Name | 2-[2-chloro-4-(methyl-methylidene-oxo-λ6-sulfanyl)-3-(2,2,2-trifluoroethoxymethyl)benzoyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 162565130 |
| Molecular Formula | C18H18ClF3O5S |
| Molecular Weight | 438.85 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | 2-[2-chloro-4-(methyl-methylidene-oxo-λ6-sulfanyl)-3-(2,2,2-trifluoroethoxymethyl)benzoyl]cyclohexane-1,3-dione |
| SMILES | C=S(C)(=O)c1ccc(C(=O)C2C(=O)CCCC2=O)c(Cl)c1COCC(F)(F)F |
| InChI | InChI=1S/C18H18ClF3O5S/c1-28(2,26)14-7-6-10(16(19)11(14)8-27-9-18(20,21)22)17(25)15-12(23)4-3-5-13(15)24/h6-7,15H,1,3-5,8-9H2,2H3 |
| InChIKey | RUTUJXSHKAKQTI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.85 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|