About 7-methoxy-4-methyl-8-(trifluoromethyl)-1,2-dihydronaphthalene
7-methoxy-4-methyl-8-(trifluoromethyl)-1,2-dihydronaphthalene (PubChem CID 162565450) has the molecular formula C13H13F3O
and a molecular weight of 242.24 g/mol. Its IUPAC name is 7-methoxy-4-methyl-8-(trifluoromethyl)-1,2-dihydronaphthalene.
Molecular Properties
| Compound Name | 7-methoxy-4-methyl-8-(trifluoromethyl)-1,2-dihydronaphthalene |
| PubChem CID | 162565450 |
| Molecular Formula | C13H13F3O |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 7-methoxy-4-methyl-8-(trifluoromethyl)-1,2-dihydronaphthalene |
| SMILES | COc1ccc2c(c1C(F)(F)F)CCC=C2C |
| InChI | InChI=1S/C13H13F3O/c1-8-4-3-5-10-9(8)6-7-11(17-2)12(10)13(14,15)16/h4,6-7H,3,5H2,1-2H3 |
| InChIKey | DHSIDECWDNVHRP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-methoxy-4-methyl-8-(trifluoromethyl)-1,2-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-4-methyl-8-(trifluoromethyl)-1,2-dihydronaphthalene?
The IUPAC name of 7-methoxy-4-methyl-8-(trifluoromethyl)-1,2-dihydronaphthalene (CID 162565450) is 7-methoxy-4-methyl-8-(trifluoromethyl)-1,2-dihydronaphthalene.
What is the SMILES notation for 7-methoxy-4-methyl-8-(trifluoromethyl)-1,2-dihydronaphthalene?
The canonical SMILES for 7-methoxy-4-methyl-8-(trifluoromethyl)-1,2-dihydronaphthalene is COc1ccc2c(c1C(F)(F)F)CCC=C2C.
What is the InChIKey of 7-methoxy-4-methyl-8-(trifluoromethyl)-1,2-dihydronaphthalene?
The InChIKey is DHSIDECWDNVHRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F3O/c1-8-4-3-5-10-9(8)6-7-11(17-2)12(10)13(14,15)16/h4,6-7H,3,5H2,1-2H3.
What are the key properties of 7-methoxy-4-methyl-8-(trifluoromethyl)-1,2-dihydronaphthalene?
7-methoxy-4-methyl-8-(trifluoromethyl)-1,2-dihydronaphthalene has a molecular weight of 242.24 g/mol, XLogP of 4.06, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-4-methyl-8-(trifluoromethyl)-1,2-dihydronaphthalene is sourced from PubChem (CID 162565450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).